About 1-nitrobut-3-en-2-one
1-nitrobut-3-en-2-one (PubChem CID 20617573) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 1-nitrobut-3-en-2-one.
Molecular Properties
| Compound Name | 1-nitrobut-3-en-2-one |
| PubChem CID | 20617573 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 1-nitrobut-3-en-2-one |
| SMILES | C=CC(=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C4H5NO3/c1-2-4(6)3-5(7)8/h2H,1,3H2 |
| InChIKey | RPPWLWXETLIUGG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrobut-3-en-2-one?
The IUPAC name of 1-nitrobut-3-en-2-one (CID 20617573) is 1-nitrobut-3-en-2-one.
What is the SMILES notation for 1-nitrobut-3-en-2-one?
The canonical SMILES for 1-nitrobut-3-en-2-one is C=CC(=O)C[N+](=O)[O-].
What is the InChIKey of 1-nitrobut-3-en-2-one?
The InChIKey is RPPWLWXETLIUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c1-2-4(6)3-5(7)8/h2H,1,3H2.
What are the key properties of 1-nitrobut-3-en-2-one?
1-nitrobut-3-en-2-one has a molecular weight of 115.09 g/mol, XLogP of 0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrobut-3-en-2-one is sourced from PubChem (CID 20617573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).