About bis(2-nitroacetate);palladium(2+)
bis(2-nitroacetate);palladium(2+) (PubChem CID 175981842) has the molecular formula C4H4N2O8Pd
and a molecular weight of 314.50 g/mol. Its IUPAC name is bis(2-nitroacetate);palladium(2+).
Molecular Properties
| Compound Name | bis(2-nitroacetate);palladium(2+) |
| PubChem CID | 175981842 |
| Molecular Formula | C4H4N2O8Pd |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | bis(2-nitroacetate);palladium(2+) |
| SMILES | O=C([O-])C[N+](=O)[O-].O=C([O-])C[N+](=O)[O-].[Pd+2] |
| InChI | InChI=1S/2C2H3NO4.Pd/c2*4-2(5)1-3(6)7;/h2*1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | UJRPGLJNLWRPBM-UHFFFAOYSA-L |
| XLogP | -3.98 |
| TPSA | 166.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-nitroacetate);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-nitroacetate);palladium(2+)?
The IUPAC name of bis(2-nitroacetate);palladium(2+) (CID 175981842) is bis(2-nitroacetate);palladium(2+).
What is the SMILES notation for bis(2-nitroacetate);palladium(2+)?
The canonical SMILES for bis(2-nitroacetate);palladium(2+) is O=C([O-])C[N+](=O)[O-].O=C([O-])C[N+](=O)[O-].[Pd+2].
What is the InChIKey of bis(2-nitroacetate);palladium(2+)?
The InChIKey is UJRPGLJNLWRPBM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H3NO4.Pd/c2*4-2(5)1-3(6)7;/h2*1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of bis(2-nitroacetate);palladium(2+)?
bis(2-nitroacetate);palladium(2+) has a molecular weight of 314.50 g/mol, XLogP of -3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-nitroacetate);palladium(2+) is sourced from PubChem (CID 175981842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).