About iron;2-nitroacetate;diacetate
iron;2-nitroacetate;diacetate (PubChem CID 173438416) has the molecular formula C6H8FeNO8-3
and a molecular weight of 277.97 g/mol. Its IUPAC name is iron;2-nitroacetate;diacetate.
Molecular Properties
| Compound Name | iron;2-nitroacetate;diacetate |
| PubChem CID | 173438416 |
| Molecular Formula | C6H8FeNO8-3 |
| Molecular Weight | 277.97 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | iron;2-nitroacetate;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].O=C([O-])C[N+](=O)[O-].[Fe] |
| InChI | InChI=1S/C2H3NO4.2C2H4O2.Fe/c4-2(5)1-3(6)7;2*1-2(3)4;/h1H2,(H,4,5);2*1H3,(H,3,4);/p-3 |
| InChIKey | JGFFZICKBATDDU-UHFFFAOYSA-K |
| XLogP | -4.48 |
| TPSA | 163.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.97 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze iron;2-nitroacetate;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-nitroacetate;diacetate?
The IUPAC name of iron;2-nitroacetate;diacetate (CID 173438416) is iron;2-nitroacetate;diacetate.
What is the SMILES notation for iron;2-nitroacetate;diacetate?
The canonical SMILES for iron;2-nitroacetate;diacetate is CC(=O)[O-].CC(=O)[O-].O=C([O-])C[N+](=O)[O-].[Fe].
What is the InChIKey of iron;2-nitroacetate;diacetate?
The InChIKey is JGFFZICKBATDDU-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H3NO4.2C2H4O2.Fe/c4-2(5)1-3(6)7;2*1-2(3)4;/h1H2,(H,4,5);2*1H3,(H,3,4);/p-3.
What are the key properties of iron;2-nitroacetate;diacetate?
iron;2-nitroacetate;diacetate has a molecular weight of 277.97 g/mol, XLogP of -4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-nitroacetate;diacetate is sourced from PubChem (CID 173438416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).