C9H11NO4 — CID 176952303
[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl] acetate (PubChem CID 176952303) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is [(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl] acetate.
| Compound Name | [(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl] acetate |
|---|---|
| PubChem CID | 176952303 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | [(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl] acetate |
| SMILES | C=C/C(=C\C=C(/C)OC(C)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C9H11NO4/c1-4-9(10(12)13)6-5-7(2)14-8(3)11/h4-6H,1H2,2-3H3/b7-5+,9-6+ |
| InChIKey | XPUVZDWCWMTBJW-PDTNFJSOSA-N |
| XLogP | 1.80 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|