C15H17ClN4O3 — CID 143480765
5-chloro-4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]oxypyrrolo[2,1-f][1,2,4]triazine;ethane (PubChem CID 143480765) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 5-chloro-4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]oxypyrrolo[2,1-f][1,2,4]triazine;ethane.
| Compound Name | 5-chloro-4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]oxypyrrolo[2,1-f][1,2,4]triazine;ethane |
|---|---|
| PubChem CID | 143480765 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-chloro-4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]oxypyrrolo[2,1-f][1,2,4]triazine;ethane |
| SMILES | C=C/C(=C\C=C(/C)Oc1ncnn2ccc(Cl)c12)[N+](=O)[O-].CC |
| InChI | InChI=1S/C13H11ClN4O3.C2H6/c1-3-10(18(19)20)5-4-9(2)21-13-12-11(14)6-7-17(12)16-8-15-13;1-2/h3-8H,1H2,2H3;1-2H3/b9-4+,10-5+; |
| InChIKey | QJWKSHUFJJETBE-YNFZUOQGSA-N |
| XLogP | 4.04 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|