C7H7Cl2NO2 — CID 126487921
(3Z,5E)-3,5-dichloro-4-nitrohepta-1,3,5-triene (PubChem CID 126487921) has the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. Its IUPAC name is (3Z,5E)-3,5-dichloro-4-nitrohepta-1,3,5-triene.
| Compound Name | (3Z,5E)-3,5-dichloro-4-nitrohepta-1,3,5-triene |
|---|---|
| PubChem CID | 126487921 |
| Molecular Formula | C7H7Cl2NO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | (3Z,5E)-3,5-dichloro-4-nitrohepta-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(C(\Cl)=C/C)/[N+](=O)[O-] |
| InChI | InChI=1S/C7H7Cl2NO2/c1-3-5(8)7(10(11)12)6(9)4-2/h3-4H,1H2,2H3/b6-4+,7-5- |
| InChIKey | MCTHVCLIMNTLKA-GUBXDBFYSA-N |
| XLogP | 3.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|