C19H28N2O2 — CID 145381545
(2Z,7Z,9E)-N-buta-1,3-dien-2-yl-6-methyl-9-nitrododeca-2,7,9,11-tetraen-5-imine;ethane (PubChem CID 145381545) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2Z,7Z,9E)-N-buta-1,3-dien-2-yl-6-methyl-9-nitrododeca-2,7,9,11-tetraen-5-imine;ethane.
| Compound Name | (2Z,7Z,9E)-N-buta-1,3-dien-2-yl-6-methyl-9-nitrododeca-2,7,9,11-tetraen-5-imine;ethane |
|---|---|
| PubChem CID | 145381545 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2Z,7Z,9E)-N-buta-1,3-dien-2-yl-6-methyl-9-nitrododeca-2,7,9,11-tetraen-5-imine;ethane |
| SMILES | C=C/C=C(\C=C/C(C)/C(C/C=C\C)=N/C(=C)C=C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C17H22N2O2.C2H6/c1-6-9-11-17(18-15(5)8-3)14(4)12-13-16(10-7-2)19(20)21;1-2/h6-10,12-14H,2-3,5,11H2,1,4H3;1-2H3/b9-6-,13-12-,16-10+,18-17+; |
| InChIKey | WYJMEFQPWRWWCO-COIOLZEUSA-N |
| XLogP | 5.66 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|