C14H26N2O3S — CID 145185381
ethane;N-[(2Z,4Z)-3-nitrohexa-2,4-dien-2-yl]sulfanyl-1-(oxan-4-yl)methanamine (PubChem CID 145185381) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is ethane;N-[(2Z,4Z)-3-nitrohexa-2,4-dien-2-yl]sulfanyl-1-(oxan-4-yl)methanamine.
| Compound Name | ethane;N-[(2Z,4Z)-3-nitrohexa-2,4-dien-2-yl]sulfanyl-1-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 145185381 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethane;N-[(2Z,4Z)-3-nitrohexa-2,4-dien-2-yl]sulfanyl-1-(oxan-4-yl)methanamine |
| SMILES | C/C=C\C(=C(/C)SNCC1CCOCC1)[N+](=O)[O-].CC |
| InChI | InChI=1S/C12H20N2O3S.C2H6/c1-3-4-12(14(15)16)10(2)18-13-9-11-5-7-17-8-6-11;1-2/h3-4,11,13H,5-9H2,1-2H3;1-2H3/b4-3-,12-10-; |
| InChIKey | GPINWCDOZLKCKH-RYMTYUSESA-N |
| XLogP | 3.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|