C10H12ClN — CID 177317779
(4Z,6E)-6-chloro-2,3-dimethylideneocta-4,6-dien-1-imine (PubChem CID 177317779) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is (4Z,6E)-6-chloro-2,3-dimethylideneocta-4,6-dien-1-imine.
| Compound Name | (4Z,6E)-6-chloro-2,3-dimethylideneocta-4,6-dien-1-imine |
|---|---|
| PubChem CID | 177317779 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (4Z,6E)-6-chloro-2,3-dimethylideneocta-4,6-dien-1-imine |
| SMILES | [H]/N=C/C(=C)C(=C)/C=C\C(Cl)=C/C |
| InChI | InChI=1S/C10H12ClN/c1-4-10(11)6-5-8(2)9(3)7-12/h4-7,12H,2-3H2,1H3/b6-5-,10-4+,12-7+ |
| InChIKey | JSQACMTTXMLVAL-SOBSOTPHSA-N |
| XLogP | 3.45 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|