C10H15ClN2O — CID 123900688
N-(2-aminoethyl)-5-chloro-2-methylidenehepta-3,5-dienamide (PubChem CID 123900688) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-chloro-2-methylidenehepta-3,5-dienamide.
| Compound Name | N-(2-aminoethyl)-5-chloro-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 123900688 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(2-aminoethyl)-5-chloro-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(C=CC(Cl)=CC)C(=O)NCCN |
| InChI | InChI=1S/C10H15ClN2O/c1-3-9(11)5-4-8(2)10(14)13-7-6-12/h3-5H,2,6-7,12H2,1H3,(H,13,14) |
| InChIKey | SQFLSNCQOUDHSN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|