C7H14N2 — CID 90261773
N'-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine (PubChem CID 90261773) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 90261773 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine |
| SMILES | C=C(C)C(=C)NCCN |
| InChI | InChI=1S/C7H14N2/c1-6(2)7(3)9-5-4-8/h9H,1,3-5,8H2,2H3 |
| InChIKey | PQHKGTJMPMIAOL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|