C6H14N2 — CID 55288959
N'-[(Z)-but-2-en-2-yl]ethane-1,2-diamine (PubChem CID 55288959) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is N'-[(Z)-but-2-en-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[(Z)-but-2-en-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 55288959 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N'-[(Z)-but-2-en-2-yl]ethane-1,2-diamine |
| SMILES | C/C=C(/C)NCCN |
| InChI | InChI=1S/C6H14N2/c1-3-6(2)8-5-4-7/h3,8H,4-5,7H2,1-2H3/b6-3- |
| InChIKey | CEWGXRQQDSQRER-UTCJRWHESA-N |
| XLogP | 0.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |