C7H16N4O — CID 134444403
2-(2-aminoethylamino)-3,3-bis(methylamino)prop-2-enal (PubChem CID 134444403) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-3,3-bis(methylamino)prop-2-enal.
| Compound Name | 2-(2-aminoethylamino)-3,3-bis(methylamino)prop-2-enal |
|---|---|
| PubChem CID | 134444403 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-(2-aminoethylamino)-3,3-bis(methylamino)prop-2-enal |
| SMILES | CNC(NC)=C(C=O)NCCN |
| InChI | InChI=1S/C7H16N4O/c1-9-7(10-2)6(5-12)11-4-3-8/h5,9-11H,3-4,8H2,1-2H3 |
| InChIKey | XFWMQRZNFYXEDB-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|