C13H21N3O3 — CID 178025115
(E)-N-(6-aminohexyl)-N'-formyl-4-methylidenepent-2-enediamide (PubChem CID 178025115) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-N'-formyl-4-methylidenepent-2-enediamide.
| Compound Name | (E)-N-(6-aminohexyl)-N'-formyl-4-methylidenepent-2-enediamide |
|---|---|
| PubChem CID | 178025115 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (E)-N-(6-aminohexyl)-N'-formyl-4-methylidenepent-2-enediamide |
| SMILES | C=C(/C=C/C(=O)NCCCCCCN)C(=O)NC=O |
| InChI | InChI=1S/C13H21N3O3/c1-11(13(19)16-10-17)6-7-12(18)15-9-5-3-2-4-8-14/h6-7,10H,1-5,8-9,14H2,(H,15,18)(H,16,17,19)/b7-6+ |
| InChIKey | MNSVAAXRYVUCGC-VOTSOKGWSA-N |
| XLogP | 0.01 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|