C18H37N7O2 — CID 10667690
(Z)-N'-[4-(3-aminopropylamino)butyl]-N-[6-(diaminomethylideneamino)hexyl]but-2-enediamide (PubChem CID 10667690) has the molecular formula C18H37N7O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (Z)-N'-[4-(3-aminopropylamino)butyl]-N-[6-(diaminomethylideneamino)hexyl]but-2-enediamide.
| Compound Name | (Z)-N'-[4-(3-aminopropylamino)butyl]-N-[6-(diaminomethylideneamino)hexyl]but-2-enediamide |
|---|---|
| PubChem CID | 10667690 |
| Molecular Formula | C18H37N7O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | (Z)-N'-[4-(3-aminopropylamino)butyl]-N-[6-(diaminomethylideneamino)hexyl]but-2-enediamide |
| SMILES | NCCCNCCCCNC(=O)/C=C\C(=O)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C18H37N7O2/c19-10-7-12-22-11-5-6-14-24-17(27)9-8-16(26)23-13-3-1-2-4-15-25-18(20)21/h8-9,22H,1-7,10-15,19H2,(H,23,26)(H,24,27)(H4,20,21,25)/b9-8- |
| InChIKey | NUDRHMJSYKVVOK-HJWRWDBZSA-N |
| XLogP | -0.67 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|