C17H37N7O3 — CID 56651909
4-(3-aminopropylamino)butyl-[2-[6-(diaminomethylideneamino)hexylamino]-2-oxoethyl]carbamic acid (PubChem CID 56651909) has the molecular formula C17H37N7O3 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-(3-aminopropylamino)butyl-[2-[6-(diaminomethylideneamino)hexylamino]-2-oxoethyl]carbamic acid.
| Compound Name | 4-(3-aminopropylamino)butyl-[2-[6-(diaminomethylideneamino)hexylamino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 56651909 |
| Molecular Formula | C17H37N7O3 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 4-(3-aminopropylamino)butyl-[2-[6-(diaminomethylideneamino)hexylamino]-2-oxoethyl]carbamic acid |
| SMILES | NCCCNCCCCN(CC(=O)NCCCCCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H37N7O3/c18-8-7-10-21-9-5-6-13-24(17(26)27)14-15(25)22-11-3-1-2-4-12-23-16(19)20/h21H,1-14,18H2,(H,22,25)(H,26,27)(H4,19,20,23) |
| InChIKey | QBLYAZBGGFEHPT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 172.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|