C16H34N6O4 — CID 142056474
2-[[2-[[2-(4-aminobutylamino)acetyl]-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate (PubChem CID 142056474) has the molecular formula C16H34N6O4 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[[2-[[2-(4-aminobutylamino)acetyl]-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-[[2-(4-aminobutylamino)acetyl]-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 142056474 |
| Molecular Formula | C16H34N6O4 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2-[[2-[[2-(4-aminobutylamino)acetyl]-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate |
| SMILES | NCCCCCN(CC(=O)NCCOC(N)=O)C(=O)CNCCCCN |
| InChI | InChI=1S/C16H34N6O4/c17-6-2-1-5-10-22(15(24)12-20-8-4-3-7-18)13-14(23)21-9-11-26-16(19)25/h20H,1-13,17-18H2,(H2,19,25)(H,21,23) |
| InChIKey | AZBAUSRFWWKXAO-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 165.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|