C12H25N5O4 — CID 142056349
2-[[2-[(2-aminoacetyl)-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate (PubChem CID 142056349) has the molecular formula C12H25N5O4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-[(2-aminoacetyl)-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 142056349 |
| Molecular Formula | C12H25N5O4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)-(5-aminopentyl)amino]acetyl]amino]ethyl carbamate |
| SMILES | NCCCCCN(CC(=O)NCCOC(N)=O)C(=O)CN |
| InChI | InChI=1S/C12H25N5O4/c13-4-2-1-3-6-17(11(19)8-14)9-10(18)16-5-7-21-12(15)20/h1-9,13-14H2,(H2,15,20)(H,16,18) |
| InChIKey | HORGCWXICOECEK-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|