C10H21N3O3 — CID 83210194
2-[(6-amino-4-methylhexanoyl)amino]ethyl carbamate (PubChem CID 83210194) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[(6-amino-4-methylhexanoyl)amino]ethyl carbamate.
| Compound Name | 2-[(6-amino-4-methylhexanoyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83210194 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[(6-amino-4-methylhexanoyl)amino]ethyl carbamate |
| SMILES | CC(CCN)CCC(=O)NCCOC(N)=O |
| InChI | InChI=1S/C10H21N3O3/c1-8(4-5-11)2-3-9(14)13-6-7-16-10(12)15/h8H,2-7,11H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | OWXAXRNLUNCERT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|