C9H19N3O3 — CID 83210184
2-[3-(propan-2-ylamino)propanoylamino]ethyl carbamate (PubChem CID 83210184) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[3-(propan-2-ylamino)propanoylamino]ethyl carbamate.
| Compound Name | 2-[3-(propan-2-ylamino)propanoylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210184 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[3-(propan-2-ylamino)propanoylamino]ethyl carbamate |
| SMILES | CC(C)NCCC(=O)NCCOC(N)=O |
| InChI | InChI=1S/C9H19N3O3/c1-7(2)11-4-3-8(13)12-5-6-15-9(10)14/h7,11H,3-6H2,1-2H3,(H2,10,14)(H,12,13) |
| InChIKey | QOIBULNTOCAEMP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|