C18H30B3N7O6 — CID 59872885
CID 59872885 (PubChem CID 59872885) has the molecular formula C18H30B3N7O6 and a molecular weight of 472.92 g/mol.
| Compound Name | CID 59872885 |
|---|---|
| PubChem CID | 59872885 |
| Molecular Formula | C18H30B3N7O6 |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CCNC(=O)CN(CCNC(=O)CN(CCN)C(=O)C[B])C(=O)C[B])CC(N)=O |
| InChI | InChI=1S/C18H30B3N7O6/c19-7-16(32)26(4-1-22)11-14(30)25-3-6-28(18(34)9-21)12-15(31)24-2-5-27(10-13(23)29)17(33)8-20/h1-12,22H2,(H2,23,29)(H,24,31)(H,25,30) |
| InChIKey | WFSJZXJMYYXUHZ-UHFFFAOYSA-N |
| XLogP | -5.09 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|