C25H53N7O4 — CID 22095007
[6-amino-2-[[2-[7-aminoheptyl-[2-(7-aminoheptylamino)acetyl]amino]acetyl]amino]hexyl] carbamate (PubChem CID 22095007) has the molecular formula C25H53N7O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is [6-amino-2-[[2-[7-aminoheptyl-[2-(7-aminoheptylamino)acetyl]amino]acetyl]amino]hexyl] carbamate.
| Compound Name | [6-amino-2-[[2-[7-aminoheptyl-[2-(7-aminoheptylamino)acetyl]amino]acetyl]amino]hexyl] carbamate |
|---|---|
| PubChem CID | 22095007 |
| Molecular Formula | C25H53N7O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.42 |
| IUPAC Name | [6-amino-2-[[2-[7-aminoheptyl-[2-(7-aminoheptylamino)acetyl]amino]acetyl]amino]hexyl] carbamate |
| SMILES | NCCCCCCCNCC(=O)N(CCCCCCCN)CC(=O)NC(CCCCN)COC(N)=O |
| InChI | InChI=1S/C25H53N7O4/c26-14-8-3-1-5-11-17-30-19-24(34)32(18-12-6-2-4-9-15-27)20-23(33)31-22(13-7-10-16-28)21-36-25(29)35/h22,30H,1-21,26-28H2,(H2,29,35)(H,31,33) |
| InChIKey | SMPQFYUZSWYWDK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 191.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|