C19H40N6O5 — CID 513306
[(2S)-6-amino-2-[[2-[4-aminobutyl-[(2R)-2,6-diaminohexanoyl]amino]acetyl]amino]hexyl] hydrogen carbonate (PubChem CID 513306) has the molecular formula C19H40N6O5 and a molecular weight of 432.57 g/mol. Its IUPAC name is [(2S)-6-amino-2-[[2-[4-aminobutyl-[(2R)-2,6-diaminohexanoyl]amino]acetyl]amino]hexyl] hydrogen carbonate.
| Compound Name | [(2S)-6-amino-2-[[2-[4-aminobutyl-[(2R)-2,6-diaminohexanoyl]amino]acetyl]amino]hexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 513306 |
| Molecular Formula | C19H40N6O5 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | [(2S)-6-amino-2-[[2-[4-aminobutyl-[(2R)-2,6-diaminohexanoyl]amino]acetyl]amino]hexyl] hydrogen carbonate |
| SMILES | NCCCC[C@@H](COC(=O)O)NC(=O)CN(CCCCN)C(=O)[C@H](N)CCCCN |
| InChI | InChI=1S/C19H40N6O5/c20-9-3-1-7-15(14-30-19(28)29)24-17(26)13-25(12-6-5-11-22)18(27)16(23)8-2-4-10-21/h15-16H,1-14,20-23H2,(H,24,26)(H,28,29)/t15-,16+/m0/s1 |
| InChIKey | DQRDNKCEIWQHLC-JKSUJKDBSA-N |
| XLogP | -0.68 |
| TPSA | 200.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|