C21H44N8O7 — CID 513292
[(2S)-6-amino-2-[[(2R)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate (PubChem CID 513292) has the molecular formula C21H44N8O7 and a molecular weight of 520.63 g/mol. Its IUPAC name is [(2S)-6-amino-2-[[(2R)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate.
| Compound Name | [(2S)-6-amino-2-[[(2R)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 513292 |
| Molecular Formula | C21H44N8O7 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | [(2S)-6-amino-2-[[(2R)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate |
| SMILES | NCCCC[C@H](COC(=O)N[C@@H](CCCCN)COC(=O)O)NC(=O)OC[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C21H44N8O7/c22-9-3-1-7-16(28-19(30)34-12-15(24)6-5-11-27-18(25)26)13-35-20(31)29-17(8-2-4-10-23)14-36-21(32)33/h15-17H,1-14,22-24H2,(H,28,30)(H,29,31)(H,32,33)(H4,25,26,27)/t15-,16+,17-/m0/s1 |
| InChIKey | CIUALRYBFZGZHF-BBWFWOEESA-N |
| XLogP | -0.49 |
| TPSA | 265.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|