C17H36N6O6 — CID 142056446
2-aminoethyl N-[6-amino-1-[(6-amino-1-carbamoyloxyhexan-2-yl)carbamoyloxy]hexan-2-yl]carbamate (PubChem CID 142056446) has the molecular formula C17H36N6O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-aminoethyl N-[6-amino-1-[(6-amino-1-carbamoyloxyhexan-2-yl)carbamoyloxy]hexan-2-yl]carbamate.
| Compound Name | 2-aminoethyl N-[6-amino-1-[(6-amino-1-carbamoyloxyhexan-2-yl)carbamoyloxy]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 142056446 |
| Molecular Formula | C17H36N6O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 2-aminoethyl N-[6-amino-1-[(6-amino-1-carbamoyloxyhexan-2-yl)carbamoyloxy]hexan-2-yl]carbamate |
| SMILES | NCCCCC(COC(N)=O)NC(=O)OCC(CCCCN)NC(=O)OCCN |
| InChI | InChI=1S/C17H36N6O6/c18-7-3-1-5-13(11-28-15(21)24)23-17(26)29-12-14(6-2-4-8-19)22-16(25)27-10-9-20/h13-14H,1-12,18-20H2,(H2,21,24)(H,22,25)(H,23,26) |
| InChIKey | YOLLXMYHLPRXLG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 207.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|