C21H44N6O7 — CID 513294
[(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate (PubChem CID 513294) has the molecular formula C21H44N6O7 and a molecular weight of 492.62 g/mol. Its IUPAC name is [(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate.
| Compound Name | [(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 513294 |
| Molecular Formula | C21H44N6O7 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | [(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexoxy]carbonylamino]hexoxy]carbonylamino]hexyl] hydrogen carbonate |
| SMILES | NCCCC[C@H](N)COC(=O)N[C@@H](CCCCN)COC(=O)N[C@@H](CCCCN)COC(=O)O |
| InChI | InChI=1S/C21H44N6O7/c22-10-4-1-7-16(25)13-32-19(28)26-17(8-2-5-11-23)14-33-20(29)27-18(9-3-6-12-24)15-34-21(30)31/h16-18H,1-15,22-25H2,(H,26,28)(H,27,29)(H,30,31)/t16-,17-,18-/m0/s1 |
| InChIKey | ATXGNDJVBUKLFC-BZSNNMDCSA-N |
| XLogP | 0.58 |
| TPSA | 227.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|