C23H48N8O6 — CID 513373
[(2R)-6-amino-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonyl-(7-aminoheptyl)amino]acetyl]amino]hexyl] hydrogen carbonate (PubChem CID 513373) has the molecular formula C23H48N8O6 and a molecular weight of 532.69 g/mol. Its IUPAC name is [(2R)-6-amino-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonyl-(7-aminoheptyl)amino]acetyl]amino]hexyl] hydrogen carbonate.
| Compound Name | [(2R)-6-amino-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonyl-(7-aminoheptyl)amino]acetyl]amino]hexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 513373 |
| Molecular Formula | C23H48N8O6 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | [(2R)-6-amino-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentoxy]carbonyl-(7-aminoheptyl)amino]acetyl]amino]hexyl] hydrogen carbonate |
| SMILES | NCCCCCCCN(CC(=O)N[C@H](CCCCN)COC(=O)O)C(=O)OC[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C23H48N8O6/c24-11-5-2-1-3-7-14-31(22(33)36-16-18(26)9-8-13-29-21(27)28)15-20(32)30-19(10-4-6-12-25)17-37-23(34)35/h18-19H,1-17,24-26H2,(H,30,32)(H,34,35)(H4,27,28,29)/t18-,19+/m0/s1 |
| InChIKey | QAOGMFLJTHIHHQ-RBUKOAKNSA-N |
| XLogP | 0.02 |
| TPSA | 247.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|