C19H40N8O5 — CID 142056421
[2-amino-5-(diaminomethylideneamino)pentyl] N-(7-aminoheptyl)-N-[2-(2-carbamoyloxyethylamino)-2-oxoethyl]carbamate (PubChem CID 142056421) has the molecular formula C19H40N8O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is [2-amino-5-(diaminomethylideneamino)pentyl] N-(7-aminoheptyl)-N-[2-(2-carbamoyloxyethylamino)-2-oxoethyl]carbamate.
| Compound Name | [2-amino-5-(diaminomethylideneamino)pentyl] N-(7-aminoheptyl)-N-[2-(2-carbamoyloxyethylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 142056421 |
| Molecular Formula | C19H40N8O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | [2-amino-5-(diaminomethylideneamino)pentyl] N-(7-aminoheptyl)-N-[2-(2-carbamoyloxyethylamino)-2-oxoethyl]carbamate |
| SMILES | NCCCCCCCN(CC(=O)NCCOC(N)=O)C(=O)OCC(N)CCCN=C(N)N |
| InChI | InChI=1S/C19H40N8O5/c20-8-4-2-1-3-5-11-27(13-16(28)25-10-12-31-18(24)29)19(30)32-14-15(21)7-6-9-26-17(22)23/h15H,1-14,20-21H2,(H2,24,29)(H,25,28)(H4,22,23,26) |
| InChIKey | SCBUTVYJBAOYGN-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 227.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|