C16H34N6O5 — CID 142056467
[6-amino-2-(2,6-diaminohexanoylamino)hexyl] N-(2-carbamoyloxyethyl)carbamate (PubChem CID 142056467) has the molecular formula C16H34N6O5 and a molecular weight of 390.49 g/mol. Its IUPAC name is [6-amino-2-(2,6-diaminohexanoylamino)hexyl] N-(2-carbamoyloxyethyl)carbamate.
| Compound Name | [6-amino-2-(2,6-diaminohexanoylamino)hexyl] N-(2-carbamoyloxyethyl)carbamate |
|---|---|
| PubChem CID | 142056467 |
| Molecular Formula | C16H34N6O5 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [6-amino-2-(2,6-diaminohexanoylamino)hexyl] N-(2-carbamoyloxyethyl)carbamate |
| SMILES | NCCCCC(COC(=O)NCCOC(N)=O)NC(=O)C(N)CCCCN |
| InChI | InChI=1S/C16H34N6O5/c17-7-3-1-5-12(22-14(23)13(19)6-2-4-8-18)11-27-16(25)21-9-10-26-15(20)24/h12-13H,1-11,17-19H2,(H2,20,24)(H,21,25)(H,22,23) |
| InChIKey | OOSUKDCSXVDPQM-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 197.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|