4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid

C10H20N4O4 — CID 18218223

IUPAC4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid
SMILESNCCCCC(N)C(=O)NC(CC(N)=O)C(=O)O
InChIInChI=1S/C10H20N4O4/c11-4-2-1-3-6(12)9(16)14-7(10(17)18)5-8(13)15/h6-7H,1-5,11-12H2,(H2,13,15)(H,14,16)(H,17,18)
InChIKeyJPNRPAJITHRXRH-UHFFFAOYSA-N
MW260.29 g/mol
LogP-2.11
Rot. Bonds9

About 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid

4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid (PubChem CID 18218223) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid
PubChem CID18218223
Molecular FormulaC10H20N4O4
Molecular Weight260.29 g/mol
Exact Mass260.15
IUPAC Name4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid
SMILESNCCCCC(N)C(=O)NC(CC(N)=O)C(=O)O
InChIInChI=1S/C10H20N4O4/c11-4-2-1-3-6(12)9(16)14-7(10(17)18)5-8(13)15/h6-7H,1-5,11-12H2,(H2,13,15)(H,14,16)(H,17,18)
InChIKeyJPNRPAJITHRXRH-UHFFFAOYSA-N
XLogP-2.11
TPSA161.53 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 5-2.11
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid?
The IUPAC name of 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid (CID 18218223) is 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid.
What is the SMILES notation for 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid?
The canonical SMILES for 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid is NCCCCC(N)C(=O)NC(CC(N)=O)C(=O)O.
What is the InChIKey of 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid?
The InChIKey is JPNRPAJITHRXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O4/c11-4-2-1-3-6(12)9(16)14-7(10(17)18)5-8(13)15/h6-7H,1-5,11-12H2,(H2,13,15)(H,14,16)(H,17,18).
What are the key properties of 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid?
4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid has a molecular weight of 260.29 g/mol, XLogP of -2.11, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid is sourced from PubChem (CID 18218223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).