C10H20N4O4 — CID 18218223
4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid (PubChem CID 18218223) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218223 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H20N4O4/c11-4-2-1-3-6(12)9(16)14-7(10(17)18)5-8(13)15/h6-7H,1-5,11-12H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | JPNRPAJITHRXRH-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|