C21H41N7O6 — CID 18310063
4-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid (PubChem CID 18310063) has the molecular formula C21H41N7O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18310063 |
| Molecular Formula | C21H41N7O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 4-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H41N7O6/c1-12(2)17(28-18(30)13(24)7-3-5-9-22)20(32)26-14(8-4-6-10-23)19(31)27-15(21(33)34)11-16(25)29/h12-15,17H,3-11,22-24H2,1-2H3,(H2,25,29)(H,26,32)(H,27,31)(H,28,30)(H,33,34) |
| InChIKey | JGWVSEDKRPXJRE-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|