C19H36N6O7 — CID 22656862
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22656862) has the molecular formula C19H36N6O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22656862 |
| Molecular Formula | C19H36N6O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CC(N)=O)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H36N6O7/c1-9(2)14(18(30)25-15(10(3)26)19(31)32)24-17(29)12(6-4-5-7-20)23-16(28)11(21)8-13(22)27/h9-12,14-15,26H,4-8,20-21H2,1-3H3,(H2,22,27)(H,23,28)(H,24,29)(H,25,30)(H,31,32) |
| InChIKey | TTWJBLUYSCFZBF-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|