C9H15N2O2P — CID 143193801
(3Z,5E)-5-[hydroxy(methyl)phosphinimyl]oxy-2-methylidenehepta-3,5-dien-1-imine (PubChem CID 143193801) has the molecular formula C9H15N2O2P and a molecular weight of 214.21 g/mol. Its IUPAC name is (3Z,5E)-5-[hydroxy(methyl)phosphinimyl]oxy-2-methylidenehepta-3,5-dien-1-imine.
| Compound Name | (3Z,5E)-5-[hydroxy(methyl)phosphinimyl]oxy-2-methylidenehepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 143193801 |
| Molecular Formula | C9H15N2O2P |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (3Z,5E)-5-[hydroxy(methyl)phosphinimyl]oxy-2-methylidenehepta-3,5-dien-1-imine |
| SMILES | [H]N=P(C)(O)OC(/C=C\C(=C)/C=N/[H])=C/C |
| InChI | InChI=1S/C9H15N2O2P/c1-4-9(13-14(3,11)12)6-5-8(2)7-10/h4-7,10H,2H2,1,3H3,(H2,11,12)/b6-5-,9-4+,10-7+ |
| InChIKey | PDMCANWDIRBDDP-KQIIPHGESA-N |
| XLogP | 2.90 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|