C7H14N2 — CID 123596480
2-N-propan-2-ylbutane-1,2-diimine (PubChem CID 123596480) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-N-propan-2-ylbutane-1,2-diimine.
| Compound Name | 2-N-propan-2-ylbutane-1,2-diimine |
|---|---|
| PubChem CID | 123596480 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-N-propan-2-ylbutane-1,2-diimine |
| SMILES | [H]/N=C/C(CC)=N/C(C)C |
| InChI | InChI=1S/C7H14N2/c1-4-7(5-8)9-6(2)3/h5-6,8H,4H2,1-3H3/b8-5+,9-7+ |
| InChIKey | GXOZJVOFWLWTON-OCIXRKKMSA-N |
| XLogP | 1.90 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|