C11H21BN2O2 — CID 144908792
(Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-1-amine (PubChem CID 144908792) has the molecular formula C11H21BN2O2 and a molecular weight of 224.11 g/mol. Its IUPAC name is (Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-1-amine.
| Compound Name | (Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-1-amine |
|---|---|
| PubChem CID | 144908792 |
| Molecular Formula | C11H21BN2O2 |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-1-amine |
| SMILES | C/N=C(C)/C(=C\N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H21BN2O2/c1-8(14-6)9(7-13)12-15-10(2,3)11(4,5)16-12/h7H,13H2,1-6H3/b9-7+,14-8+ |
| InChIKey | CHBKRMKQCJTPRI-AITIXOJYSA-N |
| XLogP | 1.55 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|