C14H27BN2O3 — CID 166474052
(Z)-3-(2-methoxyethylimino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-1-amine (PubChem CID 166474052) has the molecular formula C14H27BN2O3 and a molecular weight of 282.19 g/mol. Its IUPAC name is (Z)-3-(2-methoxyethylimino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-1-amine.
| Compound Name | (Z)-3-(2-methoxyethylimino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-1-amine |
|---|---|
| PubChem CID | 166474052 |
| Molecular Formula | C14H27BN2O3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (Z)-3-(2-methoxyethylimino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-1-amine |
| SMILES | CCC(=N\CCOC)/C(=C\N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H27BN2O3/c1-7-12(17-8-9-18-6)11(10-16)15-19-13(2,3)14(4,5)20-15/h10H,7-9,16H2,1-6H3/b11-10+,17-12+ |
| InChIKey | MFVKHARDCTVDOK-SXSSDGSKSA-N |
| XLogP | 1.96 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|