C20H31BN2O3 — CID 166473947
(Z)-4-(2-methoxyethylimino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-2-en-2-amine (PubChem CID 166473947) has the molecular formula C20H31BN2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is (Z)-4-(2-methoxyethylimino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-2-en-2-amine.
| Compound Name | (Z)-4-(2-methoxyethylimino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-2-en-2-amine |
|---|---|
| PubChem CID | 166473947 |
| Molecular Formula | C20H31BN2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (Z)-4-(2-methoxyethylimino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-2-en-2-amine |
| SMILES | COCC/N=C(C)/C(=C(/C)N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H31BN2O3/c1-14(22)18(15(2)23-12-13-24-7)16-8-10-17(11-9-16)21-25-19(3,4)20(5,6)26-21/h8-11H,12-13,22H2,1-7H3/b18-14+,23-15+ |
| InChIKey | XFUKGISQVCYNBZ-RSNHCBFKSA-N |
| XLogP | 2.78 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|