C19H28BFN2O3 — CID 166474493
(Z)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyethylimino)but-1-en-1-amine (PubChem CID 166474493) has the molecular formula C19H28BFN2O3 and a molecular weight of 362.25 g/mol. Its IUPAC name is (Z)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyethylimino)but-1-en-1-amine.
| Compound Name | (Z)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyethylimino)but-1-en-1-amine |
|---|---|
| PubChem CID | 166474493 |
| Molecular Formula | C19H28BFN2O3 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (Z)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyethylimino)but-1-en-1-amine |
| SMILES | COCC/N=C(C)/C(=C\N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H28BFN2O3/c1-13(23-9-10-24-6)16(12-22)15-8-7-14(11-17(15)21)20-25-18(2,3)19(4,5)26-20/h7-8,11-12H,9-10,22H2,1-6H3/b16-12+,23-13+ |
| InChIKey | MXTAYMWLCCIJIO-XSDFDVSCSA-N |
| XLogP | 2.53 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|