C19H27BFN3O3 — CID 174034421
2-[2-fluoro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-nitrosoethylimino)but-1-en-1-amine (PubChem CID 174034421) has the molecular formula C19H27BFN3O3 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2-[2-fluoro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-nitrosoethylimino)but-1-en-1-amine.
| Compound Name | 2-[2-fluoro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-nitrosoethylimino)but-1-en-1-amine |
|---|---|
| PubChem CID | 174034421 |
| Molecular Formula | C19H27BFN3O3 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-[2-fluoro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-nitrosoethylimino)but-1-en-1-amine |
| SMILES | C/C(=N\CCN=O)C(=CN)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1F |
| InChI | InChI=1S/C19H27BFN3O3/c1-12-16(20-26-18(3,4)19(5,6)27-20)8-7-14(17(12)21)15(11-22)13(2)23-9-10-24-25/h7-8,11H,9-10,22H2,1-6H3/b15-11?,23-13+ |
| InChIKey | PNQUZUGBOBCKJW-LCXABSQESA-N |
| XLogP | 2.96 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|