C34H42BFN2O6 — CID 160766950
ethyl 2-amino-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate;ethyl 2-(benzhydrylideneamino)acetate (PubChem CID 160766950) has the molecular formula C34H42BFN2O6 and a molecular weight of 604.53 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate;ethyl 2-(benzhydrylideneamino)acetate.
| Compound Name | ethyl 2-amino-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate;ethyl 2-(benzhydrylideneamino)acetate |
|---|---|
| PubChem CID | 160766950 |
| Molecular Formula | C34H42BFN2O6 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | ethyl 2-amino-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate;ethyl 2-(benzhydrylideneamino)acetate |
| SMILES | CCOC(=O)C(N)Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1.CCOC(=O)CN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H25BFNO4.C17H17NO2/c1-6-22-15(21)14(20)10-11-7-8-12(13(19)9-11)18-23-16(2,3)17(4,5)24-18;1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h7-9,14H,6,10,20H2,1-5H3;3-12H,2,13H2,1H3 |
| InChIKey | RYUNGVIGYFYXSV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|