C11H21BIN2O2P — CID 177003518
(Z,4E)-4-iodophosphanylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-amine (PubChem CID 177003518) has the molecular formula C11H21BIN2O2P and a molecular weight of 381.99 g/mol. Its IUPAC name is (Z,4E)-4-iodophosphanylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-amine.
| Compound Name | (Z,4E)-4-iodophosphanylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-amine |
|---|---|
| PubChem CID | 177003518 |
| Molecular Formula | C11H21BIN2O2P |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (Z,4E)-4-iodophosphanylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-amine |
| SMILES | C/C(N)=C(B1OC(C)(C)C(C)(C)O1)/C(C)=N/PI |
| InChI | InChI=1S/C11H21BIN2O2P/c1-7(14)9(8(2)15-18-13)12-16-10(3,4)11(5,6)17-12/h18H,14H2,1-6H3/b9-7+,15-8+ |
| InChIKey | GWBMMLNSALQDNO-KZVYIGENSA-N |
| XLogP | 3.25 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|