C11H20BNO3 — CID 123136704
4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-one (PubChem CID 123136704) has the molecular formula C11H20BNO3 and a molecular weight of 225.10 g/mol. Its IUPAC name is 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-one.
| Compound Name | 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-one |
|---|---|
| PubChem CID | 123136704 |
| Molecular Formula | C11H20BNO3 |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-one |
| SMILES | CC(=O)C(B1OC(C)(C)C(C)(C)O1)=C(C)N |
| InChI | InChI=1S/C11H20BNO3/c1-7(13)9(8(2)14)12-15-10(3,4)11(5,6)16-12/h13H2,1-6H3 |
| InChIKey | LDTIFYFHVZGJGD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|