C13H29BO2 — CID 144582849
ethane;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane (PubChem CID 144582849) has the molecular formula C13H29BO2 and a molecular weight of 228.18 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144582849 |
| Molecular Formula | C13H29BO2 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
| SMILES | C=C(C)B1OC(C)(C)C(C)(C)O1.CC.CC |
| InChI | InChI=1S/C9H17BO2.2C2H6/c1-7(2)10-11-8(3,4)9(5,6)12-10;2*1-2/h1H2,2-6H3;2*1-2H3 |
| InChIKey | FMZDKLBWYCCJON-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|