C24H30BBr3F2N2O2 — CID 161434426
2-bromo-4-fluoro-6-prop-1-en-2-ylaniline;2,6-dibromo-4-fluoroaniline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane (PubChem CID 161434426) has the molecular formula C24H30BBr3F2N2O2 and a molecular weight of 667.04 g/mol. Its IUPAC name is 2-bromo-4-fluoro-6-prop-1-en-2-ylaniline;2,6-dibromo-4-fluoroaniline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-bromo-4-fluoro-6-prop-1-en-2-ylaniline;2,6-dibromo-4-fluoroaniline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 161434426 |
| Molecular Formula | C24H30BBr3F2N2O2 |
| Molecular Weight | 667.04 g/mol |
| Exact Mass | 663.99 |
| IUPAC Name | 2-bromo-4-fluoro-6-prop-1-en-2-ylaniline;2,6-dibromo-4-fluoroaniline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
| SMILES | C=C(C)B1OC(C)(C)C(C)(C)O1.C=C(C)c1cc(F)cc(Br)c1N.Nc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C9H17BO2.C9H9BrFN.C6H4Br2FN/c1-7(2)10-11-8(3,4)9(5,6)12-10;1-5(2)7-3-6(11)4-8(10)9(7)12;7-4-1-3(9)2-5(8)6(4)10/h1H2,2-6H3;3-4H,1,12H2,2H3;1-2H,10H2 |
| InChIKey | VYLLBPVMPUEAOL-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.04 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|