C8H15BN2O2 — CID 123544225
1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethane-1,2-diimine (PubChem CID 123544225) has the molecular formula C8H15BN2O2 and a molecular weight of 182.03 g/mol. Its IUPAC name is 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethane-1,2-diimine.
| Compound Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 123544225 |
| Molecular Formula | C8H15BN2O2 |
| Molecular Weight | 182.03 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C8H15BN2O2/c1-7(2)8(3,4)13-9(12-7)6(11)5-10/h5,10-11H,1-4H3/b10-5+,11-6+ |
| InChIKey | KKRGQFODFVJZOP-YOYBCKCWSA-N |
| XLogP | 1.29 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.03 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|