C14H26BN2O3+ — CID 147800048
[3-imino-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-(oxan-2-yl)azanium (PubChem CID 147800048) has the molecular formula C14H26BN2O3+ and a molecular weight of 281.18 g/mol. Its IUPAC name is [3-imino-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-(oxan-2-yl)azanium.
| Compound Name | [3-imino-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-(oxan-2-yl)azanium |
|---|---|
| PubChem CID | 147800048 |
| Molecular Formula | C14H26BN2O3+ |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | [3-imino-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-(oxan-2-yl)azanium |
| SMILES | [H]/N=C/C=C([NH2+]C1CCCCO1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H25BN2O3/c1-13(2)14(3,4)20-15(19-13)11(8-9-16)17-12-7-5-6-10-18-12/h8-9,12,16-17H,5-7,10H2,1-4H3/p+1/b11-8?,16-9+ |
| InChIKey | HLIQFYMLSGCUEL-WEHMZTKHSA-O |
| XLogP | 1.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|