C14H25BO4 — CID 13347667
4,4,5,5-tetramethyl-2-[(Z)-3-(oxan-2-yloxy)prop-2-enyl]-1,3,2-dioxaborolane (PubChem CID 13347667) has the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-3-(oxan-2-yloxy)prop-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-3-(oxan-2-yloxy)prop-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 13347667 |
| Molecular Formula | C14H25BO4 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-3-(oxan-2-yloxy)prop-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C=C\OC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C14H25BO4/c1-13(2)14(3,4)19-15(18-13)9-7-11-17-12-8-5-6-10-16-12/h7,11-12H,5-6,8-10H2,1-4H3/b11-7- |
| InChIKey | VSLHQPJAVSVAOU-XFFZJAGNSA-N |
| XLogP | 3.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|