C23H30N5O3+ — CID 148903429
[1-[4-acetyl-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]-3-iminoprop-1-enyl]-(oxan-2-yl)azanium (PubChem CID 148903429) has the molecular formula C23H30N5O3+ and a molecular weight of 424.53 g/mol. Its IUPAC name is [1-[4-acetyl-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]-3-iminoprop-1-enyl]-(oxan-2-yl)azanium.
| Compound Name | [1-[4-acetyl-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]-3-iminoprop-1-enyl]-(oxan-2-yl)azanium |
|---|---|
| PubChem CID | 148903429 |
| Molecular Formula | C23H30N5O3+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [1-[4-acetyl-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]-3-iminoprop-1-enyl]-(oxan-2-yl)azanium |
| SMILES | [H]/N=C/C=C([NH2+]C1CCCCO1)c1nccc2c(C(C)=O)cc(N3CCOCC3C)nc12 |
| InChI | InChI=1S/C23H29N5O3/c1-15-14-30-12-10-28(15)20-13-18(16(2)29)17-7-9-25-23(22(17)27-20)19(6-8-24)26-21-5-3-4-11-31-21/h6-9,13,15,21,24,26H,3-5,10-12,14H2,1-2H3/p+1/b19-6?,24-8+ |
| InChIKey | PHFRQHZUSGCSDA-WFLSTHEKSA-O |
| XLogP | 2.14 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|