C21H28N8O+2 — CID 163665340
[3-amino-3-[4-(1-azaniumylidene-2-cyclopropyl-2-hydrazinylideneethyl)-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]prop-2-enylidene]azanium (PubChem CID 163665340) has the molecular formula C21H28N8O+2 and a molecular weight of 408.51 g/mol. Its IUPAC name is [3-amino-3-[4-(1-azaniumylidene-2-cyclopropyl-2-hydrazinylideneethyl)-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]prop-2-enylidene]azanium.
| Compound Name | [3-amino-3-[4-(1-azaniumylidene-2-cyclopropyl-2-hydrazinylideneethyl)-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 163665340 |
| Molecular Formula | C21H28N8O+2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [3-amino-3-[4-(1-azaniumylidene-2-cyclopropyl-2-hydrazinylideneethyl)-2-(3-methylmorpholin-4-yl)-1,7-naphthyridin-8-yl]prop-2-enylidene]azanium |
| SMILES | CC1COCCN1c1cc(C(=[NH2+])C(=NN)C2CC2)c2ccnc(C(N)=CC=[NH2+])c2n1 |
| InChI | InChI=1S/C21H26N8O/c1-12-11-30-9-8-29(12)17-10-15(18(24)19(28-25)13-2-3-13)14-5-7-26-21(20(14)27-17)16(23)4-6-22/h4-7,10,12-13,22,24H,2-3,8-9,11,23,25H2,1H3/p+2 |
| InChIKey | GOGMKMNNSAISNB-UHFFFAOYSA-P |
| XLogP | -1.74 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|