C20H23N7O — CID 174037628
3-methylimino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]prop-1-en-1-amine (PubChem CID 174037628) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-methylimino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]prop-1-en-1-amine.
| Compound Name | 3-methylimino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174037628 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-methylimino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]prop-1-en-1-amine |
| SMILES | C/N=C(\C=CN)c1cc(N2CCOCC2C)nc2c(-c3ccn[nH]3)nccc12 |
| InChI | InChI=1S/C20H23N7O/c1-13-12-28-10-9-27(13)18-11-15(16(22-2)3-6-21)14-4-7-23-20(19(14)25-18)17-5-8-24-26-17/h3-8,11,13H,9-10,12,21H2,1-2H3,(H,24,26)/b6-3?,22-16+ |
| InChIKey | XKQXLALLBWTIGK-CYNKBYRNSA-N |
| XLogP | 2.14 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|